ChemNet > CAS > 20481-33-8 diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate
20481-33-8 diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate
| product Name |
diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate |
| CAS No |
20481-33-8 |
| Synonyms |
Diethyl 2-[[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene]malonate; diethyl {[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}propanedioate |
| Molecular Formula |
C13H19N3O4 |
| Molecular Weight |
281.3077 |
| InChI |
InChI=1/C13H19N3O4/c1-5-19-12(17)10(13(18)20-6-2)8-14-11-7-9(3)15-16(11)4/h7-8,14H,5-6H2,1-4H3 |
| Molecular Structure |
![20481-33-8 diethyl 2-{[(1,3-dimethyl-1H-pyrazol-5-yl)amino]methylidene}malonate](https://images-a.chemnet.com/suppliers/chembase/302/30237.gif)
|
| Density |
1.18g/cm3 |
| Melting point |
85℃ |
| Boiling point |
366.7°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
175.6°C |
| Vapour Pressur |
1.43E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
